About (3R)-3-phenylbutanal
(3R)-3-phenylbutanal (PubChem CID 10877278) has the molecular formula C10H12O
and a molecular weight of 148.20 g/mol. Its IUPAC name is (3R)-3-phenylbutanal.
Molecular Properties
| Compound Name | (3R)-3-phenylbutanal |
| PubChem CID | 10877278 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | (3R)-3-phenylbutanal |
| SMILES | C[C@H](CC=O)c1ccccc1 |
| InChI | InChI=1S/C10H12O/c1-9(7-8-11)10-5-3-2-4-6-10/h2-6,8-9H,7H2,1H3/t9-/m1/s1 |
| InChIKey | MYHGOWDLVRDUFA-SECBINFHSA-N |
| XLogP | 2.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-phenylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-phenylbutanal?
The IUPAC name of (3R)-3-phenylbutanal (CID 10877278) is (3R)-3-phenylbutanal.
What is the SMILES notation for (3R)-3-phenylbutanal?
The canonical SMILES for (3R)-3-phenylbutanal is C[C@H](CC=O)c1ccccc1.
What is the InChIKey of (3R)-3-phenylbutanal?
The InChIKey is MYHGOWDLVRDUFA-SECBINFHSA-N. The full InChI is InChI=1S/C10H12O/c1-9(7-8-11)10-5-3-2-4-6-10/h2-6,8-9H,7H2,1H3/t9-/m1/s1.
What are the key properties of (3R)-3-phenylbutanal?
(3R)-3-phenylbutanal has a molecular weight of 148.20 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-phenylbutanal is sourced from PubChem (CID 10877278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).