About 3-pyridin-3-ylbutanal
3-pyridin-3-ylbutanal (PubChem CID 12727117) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 3-pyridin-3-ylbutanal.
Molecular Properties
| Compound Name | 3-pyridin-3-ylbutanal |
| PubChem CID | 12727117 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 3-pyridin-3-ylbutanal |
| SMILES | CC(CC=O)c1cccnc1 |
| InChI | InChI=1S/C9H11NO/c1-8(4-6-11)9-3-2-5-10-7-9/h2-3,5-8H,4H2,1H3 |
| InChIKey | FDEFZCIZYKHQDV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-pyridin-3-ylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-3-ylbutanal?
The IUPAC name of 3-pyridin-3-ylbutanal (CID 12727117) is 3-pyridin-3-ylbutanal.
What is the SMILES notation for 3-pyridin-3-ylbutanal?
The canonical SMILES for 3-pyridin-3-ylbutanal is CC(CC=O)c1cccnc1.
What is the InChIKey of 3-pyridin-3-ylbutanal?
The InChIKey is FDEFZCIZYKHQDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c1-8(4-6-11)9-3-2-5-10-7-9/h2-3,5-8H,4H2,1H3.
What are the key properties of 3-pyridin-3-ylbutanal?
3-pyridin-3-ylbutanal has a molecular weight of 149.19 g/mol, XLogP of 1.77, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-3-ylbutanal is sourced from PubChem (CID 12727117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).