About ethyl 3-pyridin-3-ylbutanoate
ethyl 3-pyridin-3-ylbutanoate (PubChem CID 12727116) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is ethyl 3-pyridin-3-ylbutanoate.
Molecular Properties
| Compound Name | ethyl 3-pyridin-3-ylbutanoate |
| PubChem CID | 12727116 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | ethyl 3-pyridin-3-ylbutanoate |
| SMILES | CCOC(=O)CC(C)c1cccnc1 |
| InChI | InChI=1S/C11H15NO2/c1-3-14-11(13)7-9(2)10-5-4-6-12-8-10/h4-6,8-9H,3,7H2,1-2H3 |
| InChIKey | AZVMTDLPURVDGH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-pyridin-3-ylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-pyridin-3-ylbutanoate?
The IUPAC name of ethyl 3-pyridin-3-ylbutanoate (CID 12727116) is ethyl 3-pyridin-3-ylbutanoate.
What is the SMILES notation for ethyl 3-pyridin-3-ylbutanoate?
The canonical SMILES for ethyl 3-pyridin-3-ylbutanoate is CCOC(=O)CC(C)c1cccnc1.
What is the InChIKey of ethyl 3-pyridin-3-ylbutanoate?
The InChIKey is AZVMTDLPURVDGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-3-14-11(13)7-9(2)10-5-4-6-12-8-10/h4-6,8-9H,3,7H2,1-2H3.
What are the key properties of ethyl 3-pyridin-3-ylbutanoate?
ethyl 3-pyridin-3-ylbutanoate has a molecular weight of 193.25 g/mol, XLogP of 2.14, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-pyridin-3-ylbutanoate is sourced from PubChem (CID 12727116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).