C12H19Cl2N3O3 — CID 70248930
ethyl 3-[(2-aminoacetyl)amino]-3-pyridin-3-ylpropanoate;dihydrochloride (PubChem CID 70248930) has the molecular formula C12H19Cl2N3O3 and a molecular weight of 324.21 g/mol. Its IUPAC name is ethyl 3-[(2-aminoacetyl)amino]-3-pyridin-3-ylpropanoate;dihydrochloride.
| Compound Name | ethyl 3-[(2-aminoacetyl)amino]-3-pyridin-3-ylpropanoate;dihydrochloride |
|---|---|
| PubChem CID | 70248930 |
| Molecular Formula | C12H19Cl2N3O3 |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | ethyl 3-[(2-aminoacetyl)amino]-3-pyridin-3-ylpropanoate;dihydrochloride |
| SMILES | CCOC(=O)CC(NC(=O)CN)c1cccnc1.Cl.Cl |
| InChI | InChI=1S/C12H17N3O3.2ClH/c1-2-18-12(17)6-10(15-11(16)7-13)9-4-3-5-14-8-9;;/h3-5,8,10H,2,6-7,13H2,1H3,(H,15,16);2*1H |
| InChIKey | KIRYTHMREFRBLC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |