C21H24N4O4 — CID 10927381
ethyl 3-[[3-(6-amino-2,3-dihydroindol-1-yl)-3-oxopropanoyl]amino]-3-pyridin-3-ylpropanoate (PubChem CID 10927381) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is ethyl 3-[[3-(6-amino-2,3-dihydroindol-1-yl)-3-oxopropanoyl]amino]-3-pyridin-3-ylpropanoate.
| Compound Name | ethyl 3-[[3-(6-amino-2,3-dihydroindol-1-yl)-3-oxopropanoyl]amino]-3-pyridin-3-ylpropanoate |
|---|---|
| PubChem CID | 10927381 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | ethyl 3-[[3-(6-amino-2,3-dihydroindol-1-yl)-3-oxopropanoyl]amino]-3-pyridin-3-ylpropanoate |
| SMILES | CCOC(=O)CC(NC(=O)CC(=O)N1CCc2ccc(N)cc21)c1cccnc1 |
| InChI | InChI=1S/C21H24N4O4/c1-2-29-21(28)11-17(15-4-3-8-23-13-15)24-19(26)12-20(27)25-9-7-14-5-6-16(22)10-18(14)25/h3-6,8,10,13,17H,2,7,9,11-12,22H2,1H3,(H,24,26) |
| InChIKey | FGCNJSCTTFVDHR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|