C26H25N5O5 — CID 11762667
3-[[3-oxo-3-[6-(phenylcarbamoylamino)-2,3-dihydroindol-1-yl]propanoyl]amino]-3-pyridin-3-ylpropanoic acid (PubChem CID 11762667) has the molecular formula C26H25N5O5 and a molecular weight of 487.52 g/mol. Its IUPAC name is 3-[[3-oxo-3-[6-(phenylcarbamoylamino)-2,3-dihydroindol-1-yl]propanoyl]amino]-3-pyridin-3-ylpropanoic acid.
| Compound Name | 3-[[3-oxo-3-[6-(phenylcarbamoylamino)-2,3-dihydroindol-1-yl]propanoyl]amino]-3-pyridin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 11762667 |
| Molecular Formula | C26H25N5O5 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 3-[[3-oxo-3-[6-(phenylcarbamoylamino)-2,3-dihydroindol-1-yl]propanoyl]amino]-3-pyridin-3-ylpropanoic acid |
| SMILES | O=C(O)CC(NC(=O)CC(=O)N1CCc2ccc(NC(=O)Nc3ccccc3)cc21)c1cccnc1 |
| InChI | InChI=1S/C26H25N5O5/c32-23(30-21(14-25(34)35)18-5-4-11-27-16-18)15-24(33)31-12-10-17-8-9-20(13-22(17)31)29-26(36)28-19-6-2-1-3-7-19/h1-9,11,13,16,21H,10,12,14-15H2,(H,30,32)(H,34,35)(H2,28,29,36) |
| InChIKey | AMFSTMCMFNTVIF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 140.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|