C22H24N6O4 — CID 67760697
ethyl 3-[[2-[3-(4-methanehydrazonoylphenyl)-2-oxoimidazol-1-yl]acetyl]amino]-3-pyridin-3-ylpropanoate (PubChem CID 67760697) has the molecular formula C22H24N6O4 and a molecular weight of 436.47 g/mol. Its IUPAC name is ethyl 3-[[2-[3-(4-methanehydrazonoylphenyl)-2-oxoimidazol-1-yl]acetyl]amino]-3-pyridin-3-ylpropanoate.
| Compound Name | ethyl 3-[[2-[3-(4-methanehydrazonoylphenyl)-2-oxoimidazol-1-yl]acetyl]amino]-3-pyridin-3-ylpropanoate |
|---|---|
| PubChem CID | 67760697 |
| Molecular Formula | C22H24N6O4 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | ethyl 3-[[2-[3-(4-methanehydrazonoylphenyl)-2-oxoimidazol-1-yl]acetyl]amino]-3-pyridin-3-ylpropanoate |
| SMILES | CCOC(=O)CC(NC(=O)Cn1ccn(-c2ccc(C=NN)cc2)c1=O)c1cccnc1 |
| InChI | InChI=1S/C22H24N6O4/c1-2-32-21(30)12-19(17-4-3-9-24-14-17)26-20(29)15-27-10-11-28(22(27)31)18-7-5-16(6-8-18)13-25-23/h3-11,13-14,19H,2,12,15,23H2,1H3,(H,26,29) |
| InChIKey | FZJLEKADZMHILJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|