C26H33N5O4 — CID 86754780
ethyl (3S)-3-[[2-[2-oxo-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]acetyl]amino]-3-pyridin-3-ylpropanoate (PubChem CID 86754780) has the molecular formula C26H33N5O4 and a molecular weight of 479.58 g/mol. Its IUPAC name is ethyl (3S)-3-[[2-[2-oxo-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]acetyl]amino]-3-pyridin-3-ylpropanoate.
| Compound Name | ethyl (3S)-3-[[2-[2-oxo-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]acetyl]amino]-3-pyridin-3-ylpropanoate |
|---|---|
| PubChem CID | 86754780 |
| Molecular Formula | C26H33N5O4 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | ethyl (3S)-3-[[2-[2-oxo-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]acetyl]amino]-3-pyridin-3-ylpropanoate |
| SMILES | CCOC(=O)C[C@H](NC(=O)CN1CCC(CCc2ccc3c(n2)NCCC3)C1=O)c1cccnc1 |
| InChI | InChI=1S/C26H33N5O4/c1-2-35-24(33)15-22(20-6-3-12-27-16-20)30-23(32)17-31-14-11-19(26(31)34)8-10-21-9-7-18-5-4-13-28-25(18)29-21/h3,6-7,9,12,16,19,22H,2,4-5,8,10-11,13-15,17H2,1H3,(H,28,29)(H,30,32)/t19?,22-/m0/s1 |
| InChIKey | NHDCHSPXJBYOGU-BPARTEKVSA-N |
| XLogP | 2.43 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |