C27H36N4O2 — CID 175693876
ethyl 3-phenyl-3-[[(1S,5R)-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]propanoate (PubChem CID 175693876) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is ethyl 3-phenyl-3-[[(1S,5R)-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]propanoate.
| Compound Name | ethyl 3-phenyl-3-[[(1S,5R)-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]propanoate |
|---|---|
| PubChem CID | 175693876 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | ethyl 3-phenyl-3-[[(1S,5R)-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]propanoate |
| SMILES | CCOC(=O)CC(NC1[C@H]2CN(CCCc3ccc4c(n3)NCCC4)C[C@@H]12)c1ccccc1 |
| InChI | InChI=1S/C27H36N4O2/c1-2-33-25(32)16-24(19-8-4-3-5-9-19)30-26-22-17-31(18-23(22)26)15-7-11-21-13-12-20-10-6-14-28-27(20)29-21/h3-5,8-9,12-13,22-24,26,30H,2,6-7,10-11,14-18H2,1H3,(H,28,29)/t22-,23+,24?,26? |
| InChIKey | AIYQJVUVQSWXKL-ZXESVQPNSA-N |
| XLogP | 3.59 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |