C27H32N4O3 — CID 54463792
ethyl 3-quinolin-3-yl-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoate (PubChem CID 54463792) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is ethyl 3-quinolin-3-yl-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoate.
| Compound Name | ethyl 3-quinolin-3-yl-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoate |
|---|---|
| PubChem CID | 54463792 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | ethyl 3-quinolin-3-yl-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoate |
| SMILES | CCOC(=O)CC(NC(=O)CCCCc1ccc2c(n1)NCCC2)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C27H32N4O3/c1-2-34-26(33)17-24(21-16-20-8-3-5-11-23(20)29-18-21)31-25(32)12-6-4-10-22-14-13-19-9-7-15-28-27(19)30-22/h3,5,8,11,13-14,16,18,24H,2,4,6-7,9-10,12,15,17H2,1H3,(H,28,30)(H,31,32) |
| InChIKey | XDLDYKSQRRNBJI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|