C29H34N4O3 — CID 70234419
ethyl (3S)-3-[2-oxo-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrrolidin-1-yl]-3-quinolin-3-ylpropanoate (PubChem CID 70234419) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is ethyl (3S)-3-[2-oxo-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrrolidin-1-yl]-3-quinolin-3-ylpropanoate.
| Compound Name | ethyl (3S)-3-[2-oxo-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrrolidin-1-yl]-3-quinolin-3-ylpropanoate |
|---|---|
| PubChem CID | 70234419 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | ethyl (3S)-3-[2-oxo-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrrolidin-1-yl]-3-quinolin-3-ylpropanoate |
| SMILES | CCOC(=O)C[C@@H](c1cnc2ccccc2c1)N1CCC(CCCc2ccc3c(n2)NCCC3)C1=O |
| InChI | InChI=1S/C29H34N4O3/c1-2-36-27(34)18-26(23-17-22-7-3-4-11-25(22)31-19-23)33-16-14-21(29(33)35)8-5-10-24-13-12-20-9-6-15-30-28(20)32-24/h3-4,7,11-13,17,19,21,26H,2,5-6,8-10,14-16,18H2,1H3,(H,30,32)/t21?,26-/m0/s1 |
| InChIKey | COQXIYQRQNWJFD-UQTORGHUSA-N |
| XLogP | 4.85 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |