C25H30N4O — CID 20691582
N-(1-quinolin-3-ylpropyl)-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanamide (PubChem CID 20691582) has the molecular formula C25H30N4O and a molecular weight of 402.54 g/mol. Its IUPAC name is N-(1-quinolin-3-ylpropyl)-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanamide.
| Compound Name | N-(1-quinolin-3-ylpropyl)-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanamide |
|---|---|
| PubChem CID | 20691582 |
| Molecular Formula | C25H30N4O |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | N-(1-quinolin-3-ylpropyl)-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanamide |
| SMILES | CCC(NC(=O)CCCCc1ccc2c(n1)NCCC2)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C25H30N4O/c1-2-22(20-16-19-8-3-5-11-23(19)27-17-20)29-24(30)12-6-4-10-21-14-13-18-9-7-15-26-25(18)28-21/h3,5,8,11,13-14,16-17,22H,2,4,6-7,9-10,12,15H2,1H3,(H,26,28)(H,29,30) |
| InChIKey | SJFMHAFDNAKNBG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|