C24H24FN3O — CID 123151596
1-(7-fluoroquinolin-3-yl)-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)hept-1-en-3-one (PubChem CID 123151596) has the molecular formula C24H24FN3O and a molecular weight of 389.47 g/mol. Its IUPAC name is 1-(7-fluoroquinolin-3-yl)-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)hept-1-en-3-one.
| Compound Name | 1-(7-fluoroquinolin-3-yl)-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)hept-1-en-3-one |
|---|---|
| PubChem CID | 123151596 |
| Molecular Formula | C24H24FN3O |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 1-(7-fluoroquinolin-3-yl)-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)hept-1-en-3-one |
| SMILES | O=C(C=Cc1cnc2cc(F)ccc2c1)CCCCc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C24H24FN3O/c25-20-10-8-19-14-17(16-27-23(19)15-20)7-12-22(29)6-2-1-5-21-11-9-18-4-3-13-26-24(18)28-21/h7-12,14-16H,1-6,13H2,(H,26,28) |
| InChIKey | AWFVWWQFODILHB-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|