C27H30N4O3 — CID 134514357
(3S)-3-quinolin-3-yl-3-[[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutanecarbonyl]amino]propanoic acid (PubChem CID 134514357) has the molecular formula C27H30N4O3 and a molecular weight of 458.56 g/mol. Its IUPAC name is (3S)-3-quinolin-3-yl-3-[[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutanecarbonyl]amino]propanoic acid.
| Compound Name | (3S)-3-quinolin-3-yl-3-[[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutanecarbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 134514357 |
| Molecular Formula | C27H30N4O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | (3S)-3-quinolin-3-yl-3-[[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutanecarbonyl]amino]propanoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)C1CC(CCc2ccc3c(n2)NCCC3)C1)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C27H30N4O3/c32-25(33)15-24(21-14-19-4-1-2-6-23(19)29-16-21)31-27(34)20-12-17(13-20)7-9-22-10-8-18-5-3-11-28-26(18)30-22/h1-2,4,6,8,10,14,16-17,20,24H,3,5,7,9,11-13,15H2,(H,28,30)(H,31,34)(H,32,33)/t17?,20?,24-/m0/s1 |
| InChIKey | BDZYCBSIBNSZRQ-KGGRFHARSA-N |
| XLogP | 4.28 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |