C24H27Cl2N3O3 — CID 139450840
3-(3,5-dichlorophenyl)-3-[[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutanecarbonyl]amino]propanoic acid (PubChem CID 139450840) has the molecular formula C24H27Cl2N3O3 and a molecular weight of 476.40 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-3-[[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutanecarbonyl]amino]propanoic acid.
| Compound Name | 3-(3,5-dichlorophenyl)-3-[[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutanecarbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 139450840 |
| Molecular Formula | C24H27Cl2N3O3 |
| Molecular Weight | 476.40 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-3-[[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutanecarbonyl]amino]propanoic acid |
| SMILES | O=C(O)CC(NC(=O)C1CC(CCc2ccc3c(n2)NCCC3)C1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C24H27Cl2N3O3/c25-18-10-16(11-19(26)12-18)21(13-22(30)31)29-24(32)17-8-14(9-17)3-5-20-6-4-15-2-1-7-27-23(15)28-20/h4,6,10-12,14,17,21H,1-3,5,7-9,13H2,(H,27,28)(H,29,32)(H,30,31) |
| InChIKey | HWOXGDFIKWEWIC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.40 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |