C23H26Cl2N4O3 — CID 134500403
(3S)-3-(3,5-dichlorophenyl)-3-[[1-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]azetidine-3-carbonyl]amino]propanoic acid (PubChem CID 134500403) has the molecular formula C23H26Cl2N4O3 and a molecular weight of 477.39 g/mol. Its IUPAC name is (3S)-3-(3,5-dichlorophenyl)-3-[[1-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]azetidine-3-carbonyl]amino]propanoic acid.
| Compound Name | (3S)-3-(3,5-dichlorophenyl)-3-[[1-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]azetidine-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 134500403 |
| Molecular Formula | C23H26Cl2N4O3 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | (3S)-3-(3,5-dichlorophenyl)-3-[[1-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]azetidine-3-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)C1CN(CCc2ccc3c(n2)NCCC3)C1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C23H26Cl2N4O3/c24-17-8-15(9-18(25)10-17)20(11-21(30)31)28-23(32)16-12-29(13-16)7-5-19-4-3-14-2-1-6-26-22(14)27-19/h3-4,8-10,16,20H,1-2,5-7,11-13H2,(H,26,27)(H,28,32)(H,30,31)/t20-/m0/s1 |
| InChIKey | KFDAJOWTYLMFAJ-FQEVSTJZSA-N |
| XLogP | 3.55 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |