C24H30Cl2N4O2 — CID 134499738
3-(3,5-dichlorophenyl)-3-[methyl-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]azetidin-3-yl]amino]propanoic acid (PubChem CID 134499738) has the molecular formula C24H30Cl2N4O2 and a molecular weight of 477.44 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-3-[methyl-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]azetidin-3-yl]amino]propanoic acid.
| Compound Name | 3-(3,5-dichlorophenyl)-3-[methyl-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]azetidin-3-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 134499738 |
| Molecular Formula | C24H30Cl2N4O2 |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-3-[methyl-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]azetidin-3-yl]amino]propanoic acid |
| SMILES | CN(C1CN(CCCc2ccc3c(n2)NCCC3)C1)C(CC(=O)O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C24H30Cl2N4O2/c1-29(22(13-23(31)32)17-10-18(25)12-19(26)11-17)21-14-30(15-21)9-3-5-20-7-6-16-4-2-8-27-24(16)28-20/h6-7,10-12,21-22H,2-5,8-9,13-15H2,1H3,(H,27,28)(H,31,32) |
| InChIKey | VZCAOEISWVRGKP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |