C26H31N5O2 — CID 163414640
(3S)-3-(3-cyanophenyl)-3-[[(1S,5R)-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]propanoic acid (PubChem CID 163414640) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is (3S)-3-(3-cyanophenyl)-3-[[(1S,5R)-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]propanoic acid.
| Compound Name | (3S)-3-(3-cyanophenyl)-3-[[(1S,5R)-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 163414640 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | (3S)-3-(3-cyanophenyl)-3-[[(1S,5R)-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]propanoic acid |
| SMILES | N#Cc1cccc([C@H](CC(=O)O)NC2[C@H]3CN(CCCc4ccc5c(n4)NCCC5)C[C@@H]23)c1 |
| InChI | InChI=1S/C26H31N5O2/c27-14-17-4-1-5-19(12-17)23(13-24(32)33)30-25-21-15-31(16-22(21)25)11-3-7-20-9-8-18-6-2-10-28-26(18)29-20/h1,4-5,8-9,12,21-23,25,30H,2-3,6-7,10-11,13,15-16H2,(H,28,29)(H,32,33)/t21-,22+,23-,25?/m0/s1 |
| InChIKey | ADITVBYHOXKVHA-PFXKXOGNSA-N |
| XLogP | 2.98 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |