C28H35F3N4O4 — CID 175693924
methyl 2-[methyl-[(1R,5S)-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]-2-phenylacetate;2,2,2-trifluoroacetic acid (PubChem CID 175693924) has the molecular formula C28H35F3N4O4 and a molecular weight of 548.61 g/mol. Its IUPAC name is methyl 2-[methyl-[(1R,5S)-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]-2-phenylacetate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl 2-[methyl-[(1R,5S)-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]-2-phenylacetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175693924 |
| Molecular Formula | C28H35F3N4O4 |
| Molecular Weight | 548.61 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | methyl 2-[methyl-[(1R,5S)-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]-2-phenylacetate;2,2,2-trifluoroacetic acid |
| SMILES | COC(=O)C(c1ccccc1)N(C)C1[C@H]2CN(CCCc3ccc4c(n3)NCCC4)C[C@@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H34N4O2.C2HF3O2/c1-29(23(26(31)32-2)18-8-4-3-5-9-18)24-21-16-30(17-22(21)24)15-7-11-20-13-12-19-10-6-14-27-25(19)28-20;3-2(4,5)1(6)7/h3-5,8-9,12-13,21-24H,6-7,10-11,14-17H2,1-2H3,(H,27,28);(H,6,7)/t21-,22+,23?,24?; |
| InChIKey | GEBLZGFAINRENB-DXYFOATESA-N |
| XLogP | 3.78 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.61 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |