C25H33N3O3 — CID 135312381
methyl 2-phenyl-2-[3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetate (PubChem CID 135312381) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is methyl 2-phenyl-2-[3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetate.
| Compound Name | methyl 2-phenyl-2-[3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 135312381 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | methyl 2-phenyl-2-[3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetate |
| SMILES | COC(=O)C(c1ccccc1)N1CCC(OCCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C25H33N3O3/c1-30-25(29)23(19-8-3-2-4-9-19)28-16-14-22(18-28)31-17-6-5-11-21-13-12-20-10-7-15-26-24(20)27-21/h2-4,8-9,12-13,22-23H,5-7,10-11,14-18H2,1H3,(H,26,27) |
| InChIKey | OLEQGKGZNZGNAK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|