C25H30F3N3O3 — CID 135312372
2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]-2-[4-(trifluoromethyl)phenyl]acetic acid (PubChem CID 135312372) has the molecular formula C25H30F3N3O3 and a molecular weight of 477.53 g/mol. Its IUPAC name is 2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]-2-[4-(trifluoromethyl)phenyl]acetic acid.
| Compound Name | 2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]-2-[4-(trifluoromethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 135312372 |
| Molecular Formula | C25H30F3N3O3 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]-2-[4-(trifluoromethyl)phenyl]acetic acid |
| SMILES | O=C(O)C(c1ccc(C(F)(F)F)cc1)N1CC[C@@H](OCCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C25H30F3N3O3/c26-25(27,28)19-9-6-17(7-10-19)22(24(32)33)31-14-12-21(16-31)34-15-2-1-5-20-11-8-18-4-3-13-29-23(18)30-20/h6-11,21-22H,1-5,12-16H2,(H,29,30)(H,32,33)/t21-,22?/m1/s1 |
| InChIKey | QOGOXTJWCYGSBU-ZMFCMNQTSA-N |
| XLogP | 4.70 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|