C24H30ClN3O3 — CID 135312185
2-(3-chlorophenyl)-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 135312185) has the molecular formula C24H30ClN3O3 and a molecular weight of 443.98 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-(3-chlorophenyl)-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 135312185 |
| Molecular Formula | C24H30ClN3O3 |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 2-(3-chlorophenyl)-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)C(c1cccc(Cl)c1)N1CC[C@@H](OCCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C24H30ClN3O3/c25-19-7-3-5-18(15-19)22(24(29)30)28-13-11-21(16-28)31-14-2-1-8-20-10-9-17-6-4-12-26-23(17)27-20/h3,5,7,9-10,15,21-22H,1-2,4,6,8,11-14,16H2,(H,26,27)(H,29,30)/t21-,22?/m1/s1 |
| InChIKey | JQQXAOOUPOISMU-ZMFCMNQTSA-N |
| XLogP | 4.33 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|