C27H34N4O3 — CID 146426106
2-(1-methylindol-4-yl)-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 146426106) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is 2-(1-methylindol-4-yl)-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-(1-methylindol-4-yl)-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 146426106 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 2-(1-methylindol-4-yl)-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | Cn1ccc2c(C(C(=O)O)N3CC[C@@H](OCCCCc4ccc5c(n4)NCCC5)C3)cccc21 |
| InChI | InChI=1S/C27H34N4O3/c1-30-15-13-22-23(8-4-9-24(22)30)25(27(32)33)31-16-12-21(18-31)34-17-3-2-7-20-11-10-19-6-5-14-28-26(19)29-20/h4,8-11,13,15,21,25H,2-3,5-7,12,14,16-18H2,1H3,(H,28,29)(H,32,33)/t21-,25?/m1/s1 |
| InChIKey | XMLVQOPAFKEURS-JGKWMGOWSA-N |
| XLogP | 4.17 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|