C26H35N3O2 — CID 159930468
1-phenyl-1-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]piperidin-1-yl]propan-2-one (PubChem CID 159930468) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 1-phenyl-1-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]piperidin-1-yl]propan-2-one.
| Compound Name | 1-phenyl-1-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]piperidin-1-yl]propan-2-one |
|---|---|
| PubChem CID | 159930468 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | 1-phenyl-1-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]piperidin-1-yl]propan-2-one |
| SMILES | CC(=O)C(c1ccccc1)N1CCC(OCCCCc2ccc3c(n2)NCCC3)CC1 |
| InChI | InChI=1S/C26H35N3O2/c1-20(30)25(21-8-3-2-4-9-21)29-17-14-24(15-18-29)31-19-6-5-11-23-13-12-22-10-7-16-27-26(22)28-23/h2-4,8-9,12-13,24-25H,5-7,10-11,14-19H2,1H3,(H,27,28) |
| InChIKey | ZGCIGVFSUGQZSP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|