C18H27N3O3 — CID 172704218
3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]pyrrolidine-1-carboxylic acid (PubChem CID 172704218) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is 3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]pyrrolidine-1-carboxylic acid.
| Compound Name | 3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 172704218 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]pyrrolidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(OCCCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C18H27N3O3/c22-18(23)21-11-9-16(13-21)24-12-3-1-2-6-15-8-7-14-5-4-10-19-17(14)20-15/h7-8,16H,1-6,9-13H2,(H,19,20)(H,22,23) |
| InChIKey | DJDKCROZKNLJBP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|