C16H27Cl2N3O — CID 146417597
7-[4-[(3R)-pyrrolidin-3-yl]oxybutyl]-1,2,3,4-tetrahydro-1,8-naphthyridine;dihydrochloride (PubChem CID 146417597) has the molecular formula C16H27Cl2N3O and a molecular weight of 348.32 g/mol. Its IUPAC name is 7-[4-[(3R)-pyrrolidin-3-yl]oxybutyl]-1,2,3,4-tetrahydro-1,8-naphthyridine;dihydrochloride.
| Compound Name | 7-[4-[(3R)-pyrrolidin-3-yl]oxybutyl]-1,2,3,4-tetrahydro-1,8-naphthyridine;dihydrochloride |
|---|---|
| PubChem CID | 146417597 |
| Molecular Formula | C16H27Cl2N3O |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 7-[4-[(3R)-pyrrolidin-3-yl]oxybutyl]-1,2,3,4-tetrahydro-1,8-naphthyridine;dihydrochloride |
| SMILES | Cl.Cl.c1cc2c(nc1CCCCO[C@@H]1CCNC1)NCCC2 |
| InChI | InChI=1S/C16H25N3O.2ClH/c1(2-11-20-15-8-10-17-12-15)5-14-7-6-13-4-3-9-18-16(13)19-14;;/h6-7,15,17H,1-5,8-12H2,(H,18,19);2*1H/t15-;;/m1../s1 |
| InChIKey | XTTVGAYMIJYOPN-QCUBGVIVSA-N |
| XLogP | 2.98 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|