C19H33N3 — CID 177029160
7-[6-(azetidin-3-yl)hexyl]-1,2,3,4-tetrahydro-1,8-naphthyridine;ethane (PubChem CID 177029160) has the molecular formula C19H33N3 and a molecular weight of 303.49 g/mol. Its IUPAC name is 7-[6-(azetidin-3-yl)hexyl]-1,2,3,4-tetrahydro-1,8-naphthyridine;ethane.
| Compound Name | 7-[6-(azetidin-3-yl)hexyl]-1,2,3,4-tetrahydro-1,8-naphthyridine;ethane |
|---|---|
| PubChem CID | 177029160 |
| Molecular Formula | C19H33N3 |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.27 |
| IUPAC Name | 7-[6-(azetidin-3-yl)hexyl]-1,2,3,4-tetrahydro-1,8-naphthyridine;ethane |
| SMILES | CC.c1cc2c(nc1CCCCCCC1CNC1)NCCC2 |
| InChI | InChI=1S/C17H27N3.C2H6/c1(3-6-14-12-18-13-14)2-4-8-16-10-9-15-7-5-11-19-17(15)20-16;1-2/h9-10,14,18H,1-8,11-13H2,(H,19,20);1-2H3 |
| InChIKey | KERKENIWEMWTEC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|