C17H28ClN3 — CID 146423102
7-(5-pyrrolidin-3-ylpentyl)-1,2,3,4-tetrahydro-1,8-naphthyridine;hydrochloride (PubChem CID 146423102) has the molecular formula C17H28ClN3 and a molecular weight of 309.88 g/mol. Its IUPAC name is 7-(5-pyrrolidin-3-ylpentyl)-1,2,3,4-tetrahydro-1,8-naphthyridine;hydrochloride.
| Compound Name | 7-(5-pyrrolidin-3-ylpentyl)-1,2,3,4-tetrahydro-1,8-naphthyridine;hydrochloride |
|---|---|
| PubChem CID | 146423102 |
| Molecular Formula | C17H28ClN3 |
| Molecular Weight | 309.88 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 7-(5-pyrrolidin-3-ylpentyl)-1,2,3,4-tetrahydro-1,8-naphthyridine;hydrochloride |
| SMILES | Cl.c1cc2c(nc1CCCCCC1CCNC1)NCCC2 |
| InChI | InChI=1S/C17H27N3.ClH/c1(2-5-14-10-12-18-13-14)3-7-16-9-8-15-6-4-11-19-17(15)20-16;/h8-9,14,18H,1-7,10-13H2,(H,19,20);1H |
| InChIKey | WOWFMNCJCSXFOV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.88 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|