C19H30N2O — CID 176954656
7-[4-[(1R)-2,2-dimethylcyclopentyl]oxybutyl]-1,2,3,4-tetrahydro-1,8-naphthyridine (PubChem CID 176954656) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is 7-[4-[(1R)-2,2-dimethylcyclopentyl]oxybutyl]-1,2,3,4-tetrahydro-1,8-naphthyridine.
| Compound Name | 7-[4-[(1R)-2,2-dimethylcyclopentyl]oxybutyl]-1,2,3,4-tetrahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 176954656 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | 7-[4-[(1R)-2,2-dimethylcyclopentyl]oxybutyl]-1,2,3,4-tetrahydro-1,8-naphthyridine |
| SMILES | CC1(C)CCC[C@H]1OCCCCc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C19H30N2O/c1-19(2)12-5-9-17(19)22-14-4-3-8-16-11-10-15-7-6-13-20-18(15)21-16/h10-11,17H,3-9,12-14H2,1-2H3,(H,20,21)/t17-/m1/s1 |
| InChIKey | QLSVXGICZGHLSV-QGZVFWFLSA-N |
| XLogP | 4.36 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|