C18H29N3 — CID 170052630
7-[5-[(3S)-pyrrolidin-3-yl]hexyl]-1,2,3,4-tetrahydro-1,8-naphthyridine (PubChem CID 170052630) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is 7-[5-[(3S)-pyrrolidin-3-yl]hexyl]-1,2,3,4-tetrahydro-1,8-naphthyridine.
| Compound Name | 7-[5-[(3S)-pyrrolidin-3-yl]hexyl]-1,2,3,4-tetrahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 170052630 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | 7-[5-[(3S)-pyrrolidin-3-yl]hexyl]-1,2,3,4-tetrahydro-1,8-naphthyridine |
| SMILES | CC(CCCCc1ccc2c(n1)NCCC2)[C@@H]1CCNC1 |
| InChI | InChI=1S/C18H29N3/c1-14(16-10-12-19-13-16)5-2-3-7-17-9-8-15-6-4-11-20-18(15)21-17/h8-9,14,16,19H,2-7,10-13H2,1H3,(H,20,21)/t14?,16-/m1/s1 |
| InChIKey | XZJBWVNFIUOLNO-BZSJEYESSA-N |
| XLogP | 3.40 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|