C18H26F2N2 — CID 139473684
7-(9,9-difluoro-5-methylidenenonyl)-1,2,3,4-tetrahydro-1,8-naphthyridine (PubChem CID 139473684) has the molecular formula C18H26F2N2 and a molecular weight of 308.42 g/mol. Its IUPAC name is 7-(9,9-difluoro-5-methylidenenonyl)-1,2,3,4-tetrahydro-1,8-naphthyridine.
| Compound Name | 7-(9,9-difluoro-5-methylidenenonyl)-1,2,3,4-tetrahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 139473684 |
| Molecular Formula | C18H26F2N2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 7-(9,9-difluoro-5-methylidenenonyl)-1,2,3,4-tetrahydro-1,8-naphthyridine |
| SMILES | C=C(CCCCc1ccc2c(n1)NCCC2)CCCC(F)F |
| InChI | InChI=1S/C18H26F2N2/c1-14(7-4-10-17(19)20)6-2-3-9-16-12-11-15-8-5-13-21-18(15)22-16/h11-12,17H,1-10,13H2,(H,21,22) |
| InChIKey | SQYGFGGFHKXWOA-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|