C17H28FN3O — CID 176962409
3-fluoro-2-methyl-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butylamino]butan-2-ol (PubChem CID 176962409) has the molecular formula C17H28FN3O and a molecular weight of 309.43 g/mol. Its IUPAC name is 3-fluoro-2-methyl-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butylamino]butan-2-ol.
| Compound Name | 3-fluoro-2-methyl-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butylamino]butan-2-ol |
|---|---|
| PubChem CID | 176962409 |
| Molecular Formula | C17H28FN3O |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | 3-fluoro-2-methyl-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butylamino]butan-2-ol |
| SMILES | CC(C)(O)C(F)CNCCCCc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C17H28FN3O/c1-17(2,22)15(18)12-19-10-4-3-7-14-9-8-13-6-5-11-20-16(13)21-14/h8-9,15,19,22H,3-7,10-12H2,1-2H3,(H,20,21) |
| InChIKey | OQTMCPSVELPLPR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|