C19H27F3N2O — CID 139473699
7-[5-methylidene-8-(2,2,2-trifluoroethoxy)octyl]-1,2,3,4-tetrahydro-1,8-naphthyridine (PubChem CID 139473699) has the molecular formula C19H27F3N2O and a molecular weight of 356.43 g/mol. Its IUPAC name is 7-[5-methylidene-8-(2,2,2-trifluoroethoxy)octyl]-1,2,3,4-tetrahydro-1,8-naphthyridine.
| Compound Name | 7-[5-methylidene-8-(2,2,2-trifluoroethoxy)octyl]-1,2,3,4-tetrahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 139473699 |
| Molecular Formula | C19H27F3N2O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 7-[5-methylidene-8-(2,2,2-trifluoroethoxy)octyl]-1,2,3,4-tetrahydro-1,8-naphthyridine |
| SMILES | C=C(CCCCc1ccc2c(n1)NCCC2)CCCOCC(F)(F)F |
| InChI | InChI=1S/C19H27F3N2O/c1-15(7-5-13-25-14-19(20,21)22)6-2-3-9-17-11-10-16-8-4-12-23-18(16)24-17/h10-11H,1-9,12-14H2,(H,23,24) |
| InChIKey | UIFQJEGKRYXICH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|