C20H33FN4O — CID 174152834
3-amino-5-[3-fluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]pentan-2-one (PubChem CID 174152834) has the molecular formula C20H33FN4O and a molecular weight of 364.51 g/mol. Its IUPAC name is 3-amino-5-[3-fluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]pentan-2-one.
| Compound Name | 3-amino-5-[3-fluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]pentan-2-one |
|---|---|
| PubChem CID | 174152834 |
| Molecular Formula | C20H33FN4O |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | 3-amino-5-[3-fluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]pentan-2-one |
| SMILES | CC(=O)C(N)CCN(CCCF)CCCCc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C20H33FN4O/c1-16(26)19(22)10-15-25(14-5-11-21)13-3-2-7-18-9-8-17-6-4-12-23-20(17)24-18/h8-9,19H,2-7,10-15,22H2,1H3,(H,23,24) |
| InChIKey | YBFODZOXAWEURN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|