C23H40N4O3 — CID 139473961
tert-butyl 2-amino-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoate (PubChem CID 139473961) has the molecular formula C23H40N4O3 and a molecular weight of 420.60 g/mol. Its IUPAC name is tert-butyl 2-amino-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoate.
| Compound Name | tert-butyl 2-amino-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoate |
|---|---|
| PubChem CID | 139473961 |
| Molecular Formula | C23H40N4O3 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.31 |
| IUPAC Name | tert-butyl 2-amino-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoate |
| SMILES | COCCN(CCCCc1ccc2c(n1)NCCC2)CCC(N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H40N4O3/c1-23(2,3)30-22(28)20(24)12-15-27(16-17-29-4)14-6-5-9-19-11-10-18-8-7-13-25-21(18)26-19/h10-11,20H,5-9,12-17,24H2,1-4H3,(H,25,26) |
| InChIKey | MCMOBWCPGCWZTI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|