C20H36N4O — CID 155277721
(3R)-1-N-(2-methoxyethyl)-1-N-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]pentane-1,3-diamine (PubChem CID 155277721) has the molecular formula C20H36N4O and a molecular weight of 348.54 g/mol. Its IUPAC name is (3R)-1-N-(2-methoxyethyl)-1-N-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]pentane-1,3-diamine.
| Compound Name | (3R)-1-N-(2-methoxyethyl)-1-N-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]pentane-1,3-diamine |
|---|---|
| PubChem CID | 155277721 |
| Molecular Formula | C20H36N4O |
| Molecular Weight | 348.54 g/mol |
| Exact Mass | 348.29 |
| IUPAC Name | (3R)-1-N-(2-methoxyethyl)-1-N-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]pentane-1,3-diamine |
| SMILES | CC[C@@H](N)CCN(CCCCc1ccc2c(n1)NCCC2)CCOC |
| InChI | InChI=1S/C20H36N4O/c1-3-18(21)11-14-24(15-16-25-2)13-5-4-8-19-10-9-17-7-6-12-22-20(17)23-19/h9-10,18H,3-8,11-16,21H2,1-2H3,(H,22,23)/t18-/m1/s1 |
| InChIKey | ONLBYAOEXQDLAS-GOSISDBHSA-N |
| XLogP | 2.84 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|