C22H35FN4O3 — CID 176962046
4-[2-(fluoromethyl)butyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-formamidobutanoic acid (PubChem CID 176962046) has the molecular formula C22H35FN4O3 and a molecular weight of 422.55 g/mol. Its IUPAC name is 4-[2-(fluoromethyl)butyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-formamidobutanoic acid.
| Compound Name | 4-[2-(fluoromethyl)butyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-formamidobutanoic acid |
|---|---|
| PubChem CID | 176962046 |
| Molecular Formula | C22H35FN4O3 |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 4-[2-(fluoromethyl)butyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-formamidobutanoic acid |
| SMILES | CCC(CF)CN(CCCCc1ccc2c(n1)NCCC2)CCC(NC=O)C(=O)O |
| InChI | InChI=1S/C22H35FN4O3/c1-2-17(14-23)15-27(13-10-20(22(29)30)25-16-28)12-4-3-7-19-9-8-18-6-5-11-24-21(18)26-19/h8-9,16-17,20H,2-7,10-15H2,1H3,(H,24,26)(H,25,28)(H,29,30) |
| InChIKey | SLGKSIRCAUUDTL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|