C23H33FN6O2 — CID 139464320
(2S)-4-[3-fluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyrimidin-4-ylamino)butanoic acid (PubChem CID 139464320) has the molecular formula C23H33FN6O2 and a molecular weight of 444.56 g/mol. Its IUPAC name is (2S)-4-[3-fluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyrimidin-4-ylamino)butanoic acid.
| Compound Name | (2S)-4-[3-fluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyrimidin-4-ylamino)butanoic acid |
|---|---|
| PubChem CID | 139464320 |
| Molecular Formula | C23H33FN6O2 |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | (2S)-4-[3-fluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyrimidin-4-ylamino)butanoic acid |
| SMILES | O=C(O)[C@H](CCN(CCCF)CCCCc1ccc2c(n1)NCCC2)Nc1ccncn1 |
| InChI | InChI=1S/C23H33FN6O2/c24-11-4-15-30(16-10-20(23(31)32)29-21-9-13-25-17-27-21)14-2-1-6-19-8-7-18-5-3-12-26-22(18)28-19/h7-9,13,17,20H,1-6,10-12,14-16H2,(H,26,28)(H,31,32)(H,25,27,29)/t20-/m0/s1 |
| InChIKey | FGIKGZRABGAHSY-FQEVSTJZSA-N |
| XLogP | 3.17 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|