C22H29BrF2N6O2 — CID 139463739
2-[(5-bromopyrimidin-4-yl)amino]-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid (PubChem CID 139463739) has the molecular formula C22H29BrF2N6O2 and a molecular weight of 527.41 g/mol. Its IUPAC name is 2-[(5-bromopyrimidin-4-yl)amino]-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid.
| Compound Name | 2-[(5-bromopyrimidin-4-yl)amino]-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
|---|---|
| PubChem CID | 139463739 |
| Molecular Formula | C22H29BrF2N6O2 |
| Molecular Weight | 527.41 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | 2-[(5-bromopyrimidin-4-yl)amino]-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
| SMILES | O=C(O)C(CCN(CCCCc1ccc2c(n1)NCCC2)CC(F)F)Nc1ncncc1Br |
| InChI | InChI=1S/C22H29BrF2N6O2/c23-17-12-26-14-28-21(17)30-18(22(32)33)8-11-31(13-19(24)25)10-2-1-5-16-7-6-15-4-3-9-27-20(15)29-16/h6-7,12,14,18-19H,1-5,8-11,13H2,(H,27,29)(H,32,33)(H,26,28,30) |
| InChIKey | DYDILDFAKXZKLT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|