C25H34FN7O3 — CID 139463473
2-[(5-cyanopyrimidin-2-yl)amino]-4-[(2-fluoro-3-methoxypropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid (PubChem CID 139463473) has the molecular formula C25H34FN7O3 and a molecular weight of 499.59 g/mol. Its IUPAC name is 2-[(5-cyanopyrimidin-2-yl)amino]-4-[(2-fluoro-3-methoxypropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid.
| Compound Name | 2-[(5-cyanopyrimidin-2-yl)amino]-4-[(2-fluoro-3-methoxypropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
|---|---|
| PubChem CID | 139463473 |
| Molecular Formula | C25H34FN7O3 |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | 2-[(5-cyanopyrimidin-2-yl)amino]-4-[(2-fluoro-3-methoxypropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
| SMILES | COCC(F)CN(CCCCc1ccc2c(n1)NCCC2)CCC(Nc1ncc(C#N)cn1)C(=O)O |
| InChI | InChI=1S/C25H34FN7O3/c1-36-17-20(26)16-33(11-3-2-6-21-8-7-19-5-4-10-28-23(19)31-21)12-9-22(24(34)35)32-25-29-14-18(13-27)15-30-25/h7-8,14-15,20,22H,2-6,9-12,16-17H2,1H3,(H,28,31)(H,34,35)(H,29,30,32) |
| InChIKey | UIUXPBJXTNSKSS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 136.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|