C26H39FN8O3 — CID 155277825
(2S)-2-[(5-amino-6-ethanimidoylpyrimidin-4-yl)amino]-4-[[(2S)-2-fluoro-3-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid (PubChem CID 155277825) has the molecular formula C26H39FN8O3 and a molecular weight of 530.65 g/mol. Its IUPAC name is (2S)-2-[(5-amino-6-ethanimidoylpyrimidin-4-yl)amino]-4-[[(2S)-2-fluoro-3-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid.
| Compound Name | (2S)-2-[(5-amino-6-ethanimidoylpyrimidin-4-yl)amino]-4-[[(2S)-2-fluoro-3-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
|---|---|
| PubChem CID | 155277825 |
| Molecular Formula | C26H39FN8O3 |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | (2S)-2-[(5-amino-6-ethanimidoylpyrimidin-4-yl)amino]-4-[[(2S)-2-fluoro-3-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
| SMILES | [H]/N=C(\C)c1ncnc(N[C@@H](CCN(CCCCc2ccc3c(n2)NCCC3)C[C@H](F)COC)C(=O)O)c1N |
| InChI | InChI=1S/C26H39FN8O3/c1-17(28)23-22(29)25(32-16-31-23)34-21(26(36)37)10-13-35(14-19(27)15-38-2)12-4-3-7-20-9-8-18-6-5-11-30-24(18)33-20/h8-9,16,19,21,28H,3-7,10-15,29H2,1-2H3,(H,30,33)(H,36,37)(H,31,32,34)/b28-17+/t19-,21-/m0/s1 |
| InChIKey | OUOCQXHVJBTYCS-ODEGZGDISA-N |
| XLogP | 2.76 |
| TPSA | 162.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|