C25H37FN6O3 — CID 139464063
4-[(2-fluoro-3-methoxypropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(5-methylpyrimidin-2-yl)amino]butanoic acid (PubChem CID 139464063) has the molecular formula C25H37FN6O3 and a molecular weight of 488.61 g/mol. Its IUPAC name is 4-[(2-fluoro-3-methoxypropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(5-methylpyrimidin-2-yl)amino]butanoic acid.
| Compound Name | 4-[(2-fluoro-3-methoxypropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(5-methylpyrimidin-2-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 139464063 |
| Molecular Formula | C25H37FN6O3 |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | 4-[(2-fluoro-3-methoxypropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(5-methylpyrimidin-2-yl)amino]butanoic acid |
| SMILES | COCC(F)CN(CCCCc1ccc2c(n1)NCCC2)CCC(Nc1ncc(C)cn1)C(=O)O |
| InChI | InChI=1S/C25H37FN6O3/c1-18-14-28-25(29-15-18)31-22(24(33)34)10-13-32(16-20(26)17-35-2)12-4-3-7-21-9-8-19-6-5-11-27-23(19)30-21/h8-9,14-15,20,22H,3-7,10-13,16-17H2,1-2H3,(H,27,30)(H,33,34)(H,28,29,31) |
| InChIKey | JJUVRVXOTZWUDI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|