C25H36F3N7O3 — CID 163211081
4-[[2-(dimethylamino)-2-hydroxyethyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]butanoic acid (PubChem CID 163211081) has the molecular formula C25H36F3N7O3 and a molecular weight of 539.60 g/mol. Its IUPAC name is 4-[[2-(dimethylamino)-2-hydroxyethyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]butanoic acid.
| Compound Name | 4-[[2-(dimethylamino)-2-hydroxyethyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 163211081 |
| Molecular Formula | C25H36F3N7O3 |
| Molecular Weight | 539.60 g/mol |
| Exact Mass | 539.28 |
| IUPAC Name | 4-[[2-(dimethylamino)-2-hydroxyethyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]butanoic acid |
| SMILES | CN(C)C(O)CN(CCCCc1ccc2c(n1)NCCC2)CCC(Nc1ncc(C(F)(F)F)cn1)C(=O)O |
| InChI | InChI=1S/C25H36F3N7O3/c1-34(2)21(36)16-35(12-4-3-7-19-9-8-17-6-5-11-29-22(17)32-19)13-10-20(23(37)38)33-24-30-14-18(15-31-24)25(26,27)28/h8-9,14-15,20-21,36H,3-7,10-13,16H2,1-2H3,(H,29,32)(H,37,38)(H,30,31,33) |
| InChIKey | ITLPPZOYANKCTN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.60 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|