C22H31F2N7O2 — CID 174206732
2-[(3-aminopyrazin-2-yl)amino]-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid (PubChem CID 174206732) has the molecular formula C22H31F2N7O2 and a molecular weight of 463.53 g/mol. Its IUPAC name is 2-[(3-aminopyrazin-2-yl)amino]-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid.
| Compound Name | 2-[(3-aminopyrazin-2-yl)amino]-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
|---|---|
| PubChem CID | 174206732 |
| Molecular Formula | C22H31F2N7O2 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | 2-[(3-aminopyrazin-2-yl)amino]-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
| SMILES | Nc1nccnc1NC(CCN(CCCCc1ccc2c(n1)NCCC2)CC(F)F)C(=O)O |
| InChI | InChI=1S/C22H31F2N7O2/c23-18(24)14-31(13-8-17(22(32)33)30-21-19(25)26-10-11-28-21)12-2-1-5-16-7-6-15-4-3-9-27-20(15)29-16/h6-7,10-11,17-18H,1-5,8-9,12-14H2,(H2,25,26)(H,27,29)(H,28,30)(H,32,33) |
| InChIKey | JXGUQTCASCPSMV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 129.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|