C23H29F2N7O2 — CID 139463676
(2S)-2-[(3-cyanopyrazin-2-yl)amino]-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid (PubChem CID 139463676) has the molecular formula C23H29F2N7O2 and a molecular weight of 473.53 g/mol. Its IUPAC name is (2S)-2-[(3-cyanopyrazin-2-yl)amino]-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid.
| Compound Name | (2S)-2-[(3-cyanopyrazin-2-yl)amino]-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
|---|---|
| PubChem CID | 139463676 |
| Molecular Formula | C23H29F2N7O2 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | (2S)-2-[(3-cyanopyrazin-2-yl)amino]-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
| SMILES | N#Cc1nccnc1N[C@@H](CCN(CCCCc1ccc2c(n1)NCCC2)CC(F)F)C(=O)O |
| InChI | InChI=1S/C23H29F2N7O2/c24-20(25)15-32(12-2-1-5-17-7-6-16-4-3-9-28-21(16)30-17)13-8-18(23(33)34)31-22-19(14-26)27-10-11-29-22/h6-7,10-11,18,20H,1-5,8-9,12-13,15H2,(H,28,30)(H,29,31)(H,33,34)/t18-/m0/s1 |
| InChIKey | VGICWPKZTPEQQJ-SFHVURJKSA-N |
| XLogP | 2.95 |
| TPSA | 127.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|