C25H34F2N8O3 — CID 139464165
(2S)-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)butanoic acid (PubChem CID 139464165) has the molecular formula C25H34F2N8O3 and a molecular weight of 532.60 g/mol. Its IUPAC name is (2S)-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)butanoic acid.
| Compound Name | (2S)-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)butanoic acid |
|---|---|
| PubChem CID | 139464165 |
| Molecular Formula | C25H34F2N8O3 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | (2S)-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)butanoic acid |
| SMILES | O=C(O)[C@H](CCN(CCCCc1ccc2c(n1)NCCC2)CCOCC(F)F)Nc1ncnc2[nH]ncc12 |
| InChI | InChI=1S/C25H34F2N8O3/c26-21(27)15-38-13-12-35(10-2-1-5-18-7-6-17-4-3-9-28-22(17)32-18)11-8-20(25(36)37)33-23-19-14-31-34-24(19)30-16-29-23/h6-7,14,16,20-21H,1-5,8-13,15H2,(H,28,32)(H,36,37)(H2,29,30,31,33,34)/t20-/m0/s1 |
| InChIKey | WXDDTAZLLHUKPR-FQEVSTJZSA-N |
| XLogP | 2.97 |
| TPSA | 141.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|