C29H34F2N8O3 — CID 139464481
4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)butanoic acid (PubChem CID 139464481) has the molecular formula C29H34F2N8O3 and a molecular weight of 580.64 g/mol. Its IUPAC name is 4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)butanoic acid.
| Compound Name | 4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)butanoic acid |
|---|---|
| PubChem CID | 139464481 |
| Molecular Formula | C29H34F2N8O3 |
| Molecular Weight | 580.64 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | 4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)butanoic acid |
| SMILES | O=C(O)C(CCN(CCCCc1ccc2c(n1)NCCC2)CCOc1cc(F)cc(F)c1)Nc1ncnc2[nH]ncc12 |
| InChI | InChI=1S/C29H34F2N8O3/c30-20-14-21(31)16-23(15-20)42-13-12-39(10-2-1-5-22-7-6-19-4-3-9-32-26(19)36-22)11-8-25(29(40)41)37-27-24-17-35-38-28(24)34-18-33-27/h6-7,14-18,25H,1-5,8-13H2,(H,32,36)(H,40,41)(H2,33,34,35,37,38) |
| InChIKey | XRUKMCRKIZMKLH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 141.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.64 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|