C31H36F2N7O3+ — CID 174153084
(2S)-2-[[6-(azet-1-ium-1-yl)pyrimidin-4-yl]amino]-4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid (PubChem CID 174153084) has the molecular formula C31H36F2N7O3+ and a molecular weight of 592.67 g/mol. Its IUPAC name is (2S)-2-[[6-(azet-1-ium-1-yl)pyrimidin-4-yl]amino]-4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid.
| Compound Name | (2S)-2-[[6-(azet-1-ium-1-yl)pyrimidin-4-yl]amino]-4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
|---|---|
| PubChem CID | 174153084 |
| Molecular Formula | C31H36F2N7O3+ |
| Molecular Weight | 592.67 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | (2S)-2-[[6-(azet-1-ium-1-yl)pyrimidin-4-yl]amino]-4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
| SMILES | O=C(O)[C@H](CCN(CCCCc1ccc2c(n1)NCCC2)CCOc1cc(F)cc(F)c1)Nc1cc([N+]2=CC=C2)ncn1 |
| InChI | InChI=1S/C31H35F2N7O3/c32-23-17-24(33)19-26(18-23)43-16-15-39(11-2-1-6-25-8-7-22-5-3-10-34-30(22)37-25)14-9-27(31(41)42)38-28-20-29(36-21-35-28)40-12-4-13-40/h4,7-8,12-13,17-21,27H,1-3,5-6,9-11,14-16H2,(H2-,34,35,36,37,38,41,42)/p+1/t27-/m0/s1 |
| InChIKey | ZEWQKAJJDLNEDY-MHZLTWQESA-O |
| XLogP | 4.41 |
| TPSA | 115.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.67 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|