C33H38FN7O3 — CID 139467845
(2S)-4-[2-[(5-fluoro-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(6-phenylpyrazin-2-yl)amino]butanoic acid (PubChem CID 139467845) has the molecular formula C33H38FN7O3 and a molecular weight of 599.71 g/mol. Its IUPAC name is (2S)-4-[2-[(5-fluoro-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(6-phenylpyrazin-2-yl)amino]butanoic acid.
| Compound Name | (2S)-4-[2-[(5-fluoro-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(6-phenylpyrazin-2-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 139467845 |
| Molecular Formula | C33H38FN7O3 |
| Molecular Weight | 599.71 g/mol |
| Exact Mass | 599.30 |
| IUPAC Name | (2S)-4-[2-[(5-fluoro-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(6-phenylpyrazin-2-yl)amino]butanoic acid |
| SMILES | O=C(O)[C@H](CCN(CCCCc1ccc2c(n1)NCCC2)CCOc1cncc(F)c1)Nc1cncc(-c2ccccc2)n1 |
| InChI | InChI=1S/C33H38FN7O3/c34-26-19-28(21-35-20-26)44-18-17-41(15-5-4-10-27-12-11-25-9-6-14-37-32(25)38-27)16-13-29(33(42)43)39-31-23-36-22-30(40-31)24-7-2-1-3-8-24/h1-3,7-8,11-12,19-23,29H,4-6,9-10,13-18H2,(H,37,38)(H,39,40)(H,42,43)/t29-/m0/s1 |
| InChIKey | KTYIRILVDKJRIQ-LJAQVGFWSA-N |
| XLogP | 5.09 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.71 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|