C29H39N7O3 — CID 139463673
4-[2-methoxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(6-pyridin-4-ylpyrazin-2-yl)amino]butanoic acid (PubChem CID 139463673) has the molecular formula C29H39N7O3 and a molecular weight of 533.68 g/mol. Its IUPAC name is 4-[2-methoxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(6-pyridin-4-ylpyrazin-2-yl)amino]butanoic acid.
| Compound Name | 4-[2-methoxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(6-pyridin-4-ylpyrazin-2-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 139463673 |
| Molecular Formula | C29H39N7O3 |
| Molecular Weight | 533.68 g/mol |
| Exact Mass | 533.31 |
| IUPAC Name | 4-[2-methoxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(6-pyridin-4-ylpyrazin-2-yl)amino]butanoic acid |
| SMILES | COC(C)CN(CCCCc1ccc2c(n1)NCCC2)CCC(Nc1cncc(-c2ccncc2)n1)C(=O)O |
| InChI | InChI=1S/C29H39N7O3/c1-21(39-2)20-36(16-4-3-7-24-9-8-23-6-5-13-32-28(23)33-24)17-12-25(29(37)38)34-27-19-31-18-26(35-27)22-10-14-30-15-11-22/h8-11,14-15,18-19,21,25H,3-7,12-13,16-17,20H2,1-2H3,(H,32,33)(H,34,35)(H,37,38) |
| InChIKey | WGEMDJMLGSFARN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.68 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|